C10H15NO8 — CID 139566523
[(3aR,6R)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-nitrooxybutanoate (PubChem CID 139566523) has the molecular formula C10H15NO8 and a molecular weight of 277.23 g/mol. Its IUPAC name is [(3aR,6R)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-nitrooxybutanoate.
| Compound Name | [(3aR,6R)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-nitrooxybutanoate |
|---|---|
| PubChem CID | 139566523 |
| Molecular Formula | C10H15NO8 |
| Molecular Weight | 277.23 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | [(3aR,6R)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-nitrooxybutanoate |
| SMILES | O=C(CCCO[N+](=O)[O-])O[C@@H]1CO[C@@H]2C(O)COC21 |
| InChI | InChI=1S/C10H15NO8/c12-6-4-16-10-7(5-17-9(6)10)19-8(13)2-1-3-18-11(14)15/h6-7,9-10,12H,1-5H2/t6?,7-,9-,10?/m1/s1 |
| InChIKey | OXOBFDYCGINKRS-ADVDVXNFSA-N |
| XLogP | -0.95 |
| TPSA | 117.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.23 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|