C11H19NO — CID 139566640
(2E,4E,6Z)-5-(methoxymethyl)-N-methylocta-2,4,6-trien-2-amine (PubChem CID 139566640) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (2E,4E,6Z)-5-(methoxymethyl)-N-methylocta-2,4,6-trien-2-amine.
| Compound Name | (2E,4E,6Z)-5-(methoxymethyl)-N-methylocta-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 139566640 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (2E,4E,6Z)-5-(methoxymethyl)-N-methylocta-2,4,6-trien-2-amine |
| SMILES | C/C=C\C(=C/C=C(\C)NC)COC |
| InChI | InChI=1S/C11H19NO/c1-5-6-11(9-13-4)8-7-10(2)12-3/h5-8,12H,9H2,1-4H3/b6-5-,10-7+,11-8+ |
| InChIKey | VZKVBUGKNDMXJB-HKAXXRRESA-N |
| XLogP | 2.26 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|