C28H43N3O4 — CID 139566676
tert-butyl 2-[[3-[[(Z,4E)-4-(dimethylaminomethylidene)-2,6-dimethyl-7-oxohept-5-en-3-ylidene]amino]-4-methylphenyl]methylamino]-3-hydroxybutanoate (PubChem CID 139566676) has the molecular formula C28H43N3O4 and a molecular weight of 485.67 g/mol. Its IUPAC name is tert-butyl 2-[[3-[[(Z,4E)-4-(dimethylaminomethylidene)-2,6-dimethyl-7-oxohept-5-en-3-ylidene]amino]-4-methylphenyl]methylamino]-3-hydroxybutanoate.
| Compound Name | tert-butyl 2-[[3-[[(Z,4E)-4-(dimethylaminomethylidene)-2,6-dimethyl-7-oxohept-5-en-3-ylidene]amino]-4-methylphenyl]methylamino]-3-hydroxybutanoate |
|---|---|
| PubChem CID | 139566676 |
| Molecular Formula | C28H43N3O4 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.33 |
| IUPAC Name | tert-butyl 2-[[3-[[(Z,4E)-4-(dimethylaminomethylidene)-2,6-dimethyl-7-oxohept-5-en-3-ylidene]amino]-4-methylphenyl]methylamino]-3-hydroxybutanoate |
| SMILES | C/C(C=O)=C/C(=C\N(C)C)/C(=N/c1cc(CNC(C(=O)OC(C)(C)C)C(C)O)ccc1C)C(C)C |
| InChI | InChI=1S/C28H43N3O4/c1-18(2)25(23(16-31(9)10)13-19(3)17-32)30-24-14-22(12-11-20(24)4)15-29-26(21(5)33)27(34)35-28(6,7)8/h11-14,16-18,21,26,29,33H,15H2,1-10H3/b19-13-,23-16+,30-25+ |
| InChIKey | LOYMRLARNLTRMO-JYXCGTSRSA-N |
| XLogP | 4.49 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|