C31H46N4O3 — CID 139566730
cyclopentyl 2-[[1-[2-(dimethylamino)ethyl]-2-[(2E,4Z)-5-methyl-6-oxohepta-2,4-dien-3-yl]benzimidazol-5-yl]methylamino]-4-methylpentanoate (PubChem CID 139566730) has the molecular formula C31H46N4O3 and a molecular weight of 522.73 g/mol. Its IUPAC name is cyclopentyl 2-[[1-[2-(dimethylamino)ethyl]-2-[(2E,4Z)-5-methyl-6-oxohepta-2,4-dien-3-yl]benzimidazol-5-yl]methylamino]-4-methylpentanoate.
| Compound Name | cyclopentyl 2-[[1-[2-(dimethylamino)ethyl]-2-[(2E,4Z)-5-methyl-6-oxohepta-2,4-dien-3-yl]benzimidazol-5-yl]methylamino]-4-methylpentanoate |
|---|---|
| PubChem CID | 139566730 |
| Molecular Formula | C31H46N4O3 |
| Molecular Weight | 522.73 g/mol |
| Exact Mass | 522.36 |
| IUPAC Name | cyclopentyl 2-[[1-[2-(dimethylamino)ethyl]-2-[(2E,4Z)-5-methyl-6-oxohepta-2,4-dien-3-yl]benzimidazol-5-yl]methylamino]-4-methylpentanoate |
| SMILES | C/C=C(\C=C(\C)C(C)=O)c1nc2cc(CNC(CC(C)C)C(=O)OC3CCCC3)ccc2n1CCN(C)C |
| InChI | InChI=1S/C31H46N4O3/c1-8-25(18-22(4)23(5)36)30-33-27-19-24(13-14-29(27)35(30)16-15-34(6)7)20-32-28(17-21(2)3)31(37)38-26-11-9-10-12-26/h8,13-14,18-19,21,26,28,32H,9-12,15-17,20H2,1-7H3/b22-18-,25-8+ |
| InChIKey | BVLYRSFQFUWGJI-ZZSGTCIXSA-N |
| XLogP | 5.53 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.73 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|