C24H29F3N2O5S — CID 139567020
(2R,3S,4R,5R)-2-(hydroxymethyl)-6-[2-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propylamino]ethyl]oxane-3,4,5-triol (PubChem CID 139567020) has the molecular formula C24H29F3N2O5S and a molecular weight of 514.57 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-(hydroxymethyl)-6-[2-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propylamino]ethyl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-6-[2-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propylamino]ethyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 139567020 |
| Molecular Formula | C24H29F3N2O5S |
| Molecular Weight | 514.57 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-6-[2-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propylamino]ethyl]oxane-3,4,5-triol |
| SMILES | OC[C@H]1OC(CCNCCCN2c3ccccc3Sc3ccc(C(F)(F)F)cc32)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H29F3N2O5S/c25-24(26,27)14-6-7-20-16(12-14)29(15-4-1-2-5-19(15)35-20)11-3-9-28-10-8-17-21(31)23(33)22(32)18(13-30)34-17/h1-2,4-7,12,17-18,21-23,28,30-33H,3,8-11,13H2/t17?,18-,21+,22-,23-/m1/s1 |
| InChIKey | LIXGWAQQCYNRNL-JQACFINFSA-N |
| XLogP | 2.52 |
| TPSA | 105.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.57 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|