C43H30N4 — CID 139567433
12-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-10,10-dimethyl-2-azapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12,14,16,18,20-decaene (PubChem CID 139567433) has the molecular formula C43H30N4 and a molecular weight of 602.74 g/mol. Its IUPAC name is 12-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-10,10-dimethyl-2-azapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12,14,16,18,20-decaene.
| Compound Name | 12-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-10,10-dimethyl-2-azapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12,14,16,18,20-decaene |
|---|---|
| PubChem CID | 139567433 |
| Molecular Formula | C43H30N4 |
| Molecular Weight | 602.74 g/mol |
| Exact Mass | 602.25 |
| IUPAC Name | 12-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-10,10-dimethyl-2-azapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12,14,16,18,20-decaene |
| SMILES | CC1(C)c2ccccc2-c2nc3c(ccc4ccccc43)c(-c3ccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc3)c21 |
| InChI | InChI=1S/C43H30N4/c1-43(2)35-20-12-11-19-33(35)39-37(43)36(34-26-25-27-13-9-10-18-32(27)38(34)44-39)28-21-23-31(24-22-28)42-46-40(29-14-5-3-6-15-29)45-41(47-42)30-16-7-4-8-17-30/h3-26H,1-2H3 |
| InChIKey | JPTDRYUOGOJVRN-UHFFFAOYSA-N |
| XLogP | 10.55 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.74 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|