C9H11F2NO4 — CID 139567529
3,3-difluoroprop-2-enyl 2-morpholin-4-yl-2-oxoacetate (PubChem CID 139567529) has the molecular formula C9H11F2NO4 and a molecular weight of 235.19 g/mol. Its IUPAC name is 3,3-difluoroprop-2-enyl 2-morpholin-4-yl-2-oxoacetate.
| Compound Name | 3,3-difluoroprop-2-enyl 2-morpholin-4-yl-2-oxoacetate |
|---|---|
| PubChem CID | 139567529 |
| Molecular Formula | C9H11F2NO4 |
| Molecular Weight | 235.19 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 3,3-difluoroprop-2-enyl 2-morpholin-4-yl-2-oxoacetate |
| SMILES | O=C(OCC=C(F)F)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C9H11F2NO4/c10-7(11)1-4-16-9(14)8(13)12-2-5-15-6-3-12/h1H,2-6H2 |
| InChIKey | UQHISMPWQZGKNL-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.19 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|