C9H7F8NO3 — CID 139567532
[(E)-2,3,4,4,4-pentafluorobut-2-enyl] 2-[methyl(2,2,2-trifluoroethyl)amino]-2-oxoacetate (PubChem CID 139567532) has the molecular formula C9H7F8NO3 and a molecular weight of 329.14 g/mol. Its IUPAC name is [(E)-2,3,4,4,4-pentafluorobut-2-enyl] 2-[methyl(2,2,2-trifluoroethyl)amino]-2-oxoacetate.
| Compound Name | [(E)-2,3,4,4,4-pentafluorobut-2-enyl] 2-[methyl(2,2,2-trifluoroethyl)amino]-2-oxoacetate |
|---|---|
| PubChem CID | 139567532 |
| Molecular Formula | C9H7F8NO3 |
| Molecular Weight | 329.14 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | [(E)-2,3,4,4,4-pentafluorobut-2-enyl] 2-[methyl(2,2,2-trifluoroethyl)amino]-2-oxoacetate |
| SMILES | CN(CC(F)(F)F)C(=O)C(=O)OC/C(F)=C(\F)C(F)(F)F |
| InChI | InChI=1S/C9H7F8NO3/c1-18(3-8(12,13)14)6(19)7(20)21-2-4(10)5(11)9(15,16)17/h2-3H2,1H3/b5-4+ |
| InChIKey | DJRUCJJGHUHJNF-SNAWJCMRSA-N |
| XLogP | 2.26 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.14 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|