C10H6F5N3O3 — CID 139567533
[(E)-2,3,4,4,4-pentafluorobut-2-enyl] 2-[bis(cyanomethyl)amino]-2-oxoacetate (PubChem CID 139567533) has the molecular formula C10H6F5N3O3 and a molecular weight of 311.17 g/mol. Its IUPAC name is [(E)-2,3,4,4,4-pentafluorobut-2-enyl] 2-[bis(cyanomethyl)amino]-2-oxoacetate.
| Compound Name | [(E)-2,3,4,4,4-pentafluorobut-2-enyl] 2-[bis(cyanomethyl)amino]-2-oxoacetate |
|---|---|
| PubChem CID | 139567533 |
| Molecular Formula | C10H6F5N3O3 |
| Molecular Weight | 311.17 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | [(E)-2,3,4,4,4-pentafluorobut-2-enyl] 2-[bis(cyanomethyl)amino]-2-oxoacetate |
| SMILES | N#CCN(CC#N)C(=O)C(=O)OC/C(F)=C(\F)C(F)(F)F |
| InChI | InChI=1S/C10H6F5N3O3/c11-6(7(12)10(13,14)15)5-21-9(20)8(19)18(3-1-16)4-2-17/h3-5H2/b7-6+ |
| InChIKey | FRFIYKZCLSZYBX-VOTSOKGWSA-N |
| XLogP | 1.12 |
| TPSA | 94.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.17 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|