C9H7F6NO3 — CID 139567543
4,4,4-trifluorobut-2-ynyl 2-[methyl(2,2,2-trifluoroethyl)amino]-2-oxoacetate (PubChem CID 139567543) has the molecular formula C9H7F6NO3 and a molecular weight of 291.15 g/mol. Its IUPAC name is 4,4,4-trifluorobut-2-ynyl 2-[methyl(2,2,2-trifluoroethyl)amino]-2-oxoacetate.
| Compound Name | 4,4,4-trifluorobut-2-ynyl 2-[methyl(2,2,2-trifluoroethyl)amino]-2-oxoacetate |
|---|---|
| PubChem CID | 139567543 |
| Molecular Formula | C9H7F6NO3 |
| Molecular Weight | 291.15 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 4,4,4-trifluorobut-2-ynyl 2-[methyl(2,2,2-trifluoroethyl)amino]-2-oxoacetate |
| SMILES | CN(CC(F)(F)F)C(=O)C(=O)OCC#CC(F)(F)F |
| InChI | InChI=1S/C9H7F6NO3/c1-16(5-9(13,14)15)6(17)7(18)19-4-2-3-8(10,11)12/h4-5H2,1H3 |
| InChIKey | MXKYSSXJMKHWJM-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.15 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|