C13H15F4NO3 — CID 139567579
[(Z)-3,4,4,4-tetrafluorobut-2-enyl] 2-[tert-butyl(prop-2-ynyl)amino]-2-oxoacetate (PubChem CID 139567579) has the molecular formula C13H15F4NO3 and a molecular weight of 309.26 g/mol. Its IUPAC name is [(Z)-3,4,4,4-tetrafluorobut-2-enyl] 2-[tert-butyl(prop-2-ynyl)amino]-2-oxoacetate.
| Compound Name | [(Z)-3,4,4,4-tetrafluorobut-2-enyl] 2-[tert-butyl(prop-2-ynyl)amino]-2-oxoacetate |
|---|---|
| PubChem CID | 139567579 |
| Molecular Formula | C13H15F4NO3 |
| Molecular Weight | 309.26 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | [(Z)-3,4,4,4-tetrafluorobut-2-enyl] 2-[tert-butyl(prop-2-ynyl)amino]-2-oxoacetate |
| SMILES | C#CCN(C(=O)C(=O)OC/C=C(\F)C(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C13H15F4NO3/c1-5-7-18(12(2,3)4)10(19)11(20)21-8-6-9(14)13(15,16)17/h1,6H,7-8H2,2-4H3/b9-6- |
| InChIKey | TWFJOJLWSLKOAQ-TWGQIWQCSA-N |
| XLogP | 2.21 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|