C9H9F4NO4 — CID 139567583
[(Z)-3,4,4,4-tetrafluorobut-2-enyl] 2-(1,3-oxazolidin-3-yl)-2-oxoacetate (PubChem CID 139567583) has the molecular formula C9H9F4NO4 and a molecular weight of 271.17 g/mol. Its IUPAC name is [(Z)-3,4,4,4-tetrafluorobut-2-enyl] 2-(1,3-oxazolidin-3-yl)-2-oxoacetate.
| Compound Name | [(Z)-3,4,4,4-tetrafluorobut-2-enyl] 2-(1,3-oxazolidin-3-yl)-2-oxoacetate |
|---|---|
| PubChem CID | 139567583 |
| Molecular Formula | C9H9F4NO4 |
| Molecular Weight | 271.17 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | [(Z)-3,4,4,4-tetrafluorobut-2-enyl] 2-(1,3-oxazolidin-3-yl)-2-oxoacetate |
| SMILES | O=C(OC/C=C(\F)C(F)(F)F)C(=O)N1CCOC1 |
| InChI | InChI=1S/C9H9F4NO4/c10-6(9(11,12)13)1-3-18-8(16)7(15)14-2-4-17-5-14/h1H,2-5H2/b6-1- |
| InChIKey | BLHWKCLKYCWERD-BHQIHCQQSA-N |
| XLogP | 0.76 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.17 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|