About 2-fluoroprop-2-enyl 2-(dimethylamino)-2-oxoacetate
2-fluoroprop-2-enyl 2-(dimethylamino)-2-oxoacetate (PubChem CID 139567588) has the molecular formula C7H10FNO3
and a molecular weight of 175.16 g/mol. Its IUPAC name is 2-fluoroprop-2-enyl 2-(dimethylamino)-2-oxoacetate.
Molecular Properties
| Compound Name | 2-fluoroprop-2-enyl 2-(dimethylamino)-2-oxoacetate |
| PubChem CID | 139567588 |
| Molecular Formula | C7H10FNO3 |
| Molecular Weight | 175.16 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 2-fluoroprop-2-enyl 2-(dimethylamino)-2-oxoacetate |
| SMILES | C=C(F)COC(=O)C(=O)N(C)C |
| InChI | InChI=1S/C7H10FNO3/c1-5(8)4-12-7(11)6(10)9(2)3/h1,4H2,2-3H3 |
| InChIKey | QDEUAFQFBZJEIF-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.16 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoroprop-2-enyl 2-(dimethylamino)-2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoroprop-2-enyl 2-(dimethylamino)-2-oxoacetate?
The IUPAC name of 2-fluoroprop-2-enyl 2-(dimethylamino)-2-oxoacetate (CID 139567588) is 2-fluoroprop-2-enyl 2-(dimethylamino)-2-oxoacetate.
What is the SMILES notation for 2-fluoroprop-2-enyl 2-(dimethylamino)-2-oxoacetate?
The canonical SMILES for 2-fluoroprop-2-enyl 2-(dimethylamino)-2-oxoacetate is C=C(F)COC(=O)C(=O)N(C)C.
What is the InChIKey of 2-fluoroprop-2-enyl 2-(dimethylamino)-2-oxoacetate?
The InChIKey is QDEUAFQFBZJEIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10FNO3/c1-5(8)4-12-7(11)6(10)9(2)3/h1,4H2,2-3H3.
What are the key properties of 2-fluoroprop-2-enyl 2-(dimethylamino)-2-oxoacetate?
2-fluoroprop-2-enyl 2-(dimethylamino)-2-oxoacetate has a molecular weight of 175.16 g/mol, XLogP of 0.10, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoroprop-2-enyl 2-(dimethylamino)-2-oxoacetate is sourced from PubChem (CID 139567588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).