About 2-fluoroprop-2-enyl 2-[tert-butyl(prop-2-enyl)amino]-2-oxoacetate
2-fluoroprop-2-enyl 2-[tert-butyl(prop-2-enyl)amino]-2-oxoacetate (PubChem CID 139567590) has the molecular formula C12H18FNO3
and a molecular weight of 243.28 g/mol. Its IUPAC name is 2-fluoroprop-2-enyl 2-[tert-butyl(prop-2-enyl)amino]-2-oxoacetate.
Molecular Properties
| Compound Name | 2-fluoroprop-2-enyl 2-[tert-butyl(prop-2-enyl)amino]-2-oxoacetate |
| PubChem CID | 139567590 |
| Molecular Formula | C12H18FNO3 |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 2-fluoroprop-2-enyl 2-[tert-butyl(prop-2-enyl)amino]-2-oxoacetate |
| SMILES | C=CCN(C(=O)C(=O)OCC(=C)F)C(C)(C)C |
| InChI | InChI=1S/C12H18FNO3/c1-6-7-14(12(3,4)5)10(15)11(16)17-8-9(2)13/h6H,1-2,7-8H2,3-5H3 |
| InChIKey | VWSNXRZUGIVITF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoroprop-2-enyl 2-[tert-butyl(prop-2-enyl)amino]-2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoroprop-2-enyl 2-[tert-butyl(prop-2-enyl)amino]-2-oxoacetate?
The IUPAC name of 2-fluoroprop-2-enyl 2-[tert-butyl(prop-2-enyl)amino]-2-oxoacetate (CID 139567590) is 2-fluoroprop-2-enyl 2-[tert-butyl(prop-2-enyl)amino]-2-oxoacetate.
What is the SMILES notation for 2-fluoroprop-2-enyl 2-[tert-butyl(prop-2-enyl)amino]-2-oxoacetate?
The canonical SMILES for 2-fluoroprop-2-enyl 2-[tert-butyl(prop-2-enyl)amino]-2-oxoacetate is C=CCN(C(=O)C(=O)OCC(=C)F)C(C)(C)C.
What is the InChIKey of 2-fluoroprop-2-enyl 2-[tert-butyl(prop-2-enyl)amino]-2-oxoacetate?
The InChIKey is VWSNXRZUGIVITF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18FNO3/c1-6-7-14(12(3,4)5)10(15)11(16)17-8-9(2)13/h6H,1-2,7-8H2,3-5H3.
What are the key properties of 2-fluoroprop-2-enyl 2-[tert-butyl(prop-2-enyl)amino]-2-oxoacetate?
2-fluoroprop-2-enyl 2-[tert-butyl(prop-2-enyl)amino]-2-oxoacetate has a molecular weight of 243.28 g/mol, XLogP of 1.83, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoroprop-2-enyl 2-[tert-butyl(prop-2-enyl)amino]-2-oxoacetate is sourced from PubChem (CID 139567590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).