C9H9F6NO3 — CID 139567621
[(E)-4,4,4-trifluorobut-2-enyl] 2-[methyl(2,2,2-trifluoroethyl)amino]-2-oxoacetate (PubChem CID 139567621) has the molecular formula C9H9F6NO3 and a molecular weight of 293.16 g/mol. Its IUPAC name is [(E)-4,4,4-trifluorobut-2-enyl] 2-[methyl(2,2,2-trifluoroethyl)amino]-2-oxoacetate.
| Compound Name | [(E)-4,4,4-trifluorobut-2-enyl] 2-[methyl(2,2,2-trifluoroethyl)amino]-2-oxoacetate |
|---|---|
| PubChem CID | 139567621 |
| Molecular Formula | C9H9F6NO3 |
| Molecular Weight | 293.16 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | [(E)-4,4,4-trifluorobut-2-enyl] 2-[methyl(2,2,2-trifluoroethyl)amino]-2-oxoacetate |
| SMILES | CN(CC(F)(F)F)C(=O)C(=O)OC/C=C/C(F)(F)F |
| InChI | InChI=1S/C9H9F6NO3/c1-16(5-9(13,14)15)6(17)7(18)19-4-2-3-8(10,11)12/h2-3H,4-5H2,1H3/b3-2+ |
| InChIKey | AZYBQCHZEKSSKI-NSCUHMNNSA-N |
| XLogP | 1.67 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.16 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|