About 2,3,3-trifluoroprop-2-enyl 2-oxo-2-[prop-2-enyl(prop-2-ynyl)amino]acetate
2,3,3-trifluoroprop-2-enyl 2-oxo-2-[prop-2-enyl(prop-2-ynyl)amino]acetate (PubChem CID 139567630) has the molecular formula C11H10F3NO3
and a molecular weight of 261.20 g/mol. Its IUPAC name is 2,3,3-trifluoroprop-2-enyl 2-oxo-2-[prop-2-enyl(prop-2-ynyl)amino]acetate.
Molecular Properties
| Compound Name | 2,3,3-trifluoroprop-2-enyl 2-oxo-2-[prop-2-enyl(prop-2-ynyl)amino]acetate |
| PubChem CID | 139567630 |
| Molecular Formula | C11H10F3NO3 |
| Molecular Weight | 261.20 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 2,3,3-trifluoroprop-2-enyl 2-oxo-2-[prop-2-enyl(prop-2-ynyl)amino]acetate |
| SMILES | C#CCN(CC=C)C(=O)C(=O)OCC(F)=C(F)F |
| InChI | InChI=1S/C11H10F3NO3/c1-3-5-15(6-4-2)10(16)11(17)18-7-8(12)9(13)14/h1,4H,2,5-7H2 |
| InChIKey | RQZURASQAGWJPJ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.20 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,3,3-trifluoroprop-2-enyl 2-oxo-2-[prop-2-enyl(prop-2-ynyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,3-trifluoroprop-2-enyl 2-oxo-2-[prop-2-enyl(prop-2-ynyl)amino]acetate?
The IUPAC name of 2,3,3-trifluoroprop-2-enyl 2-oxo-2-[prop-2-enyl(prop-2-ynyl)amino]acetate (CID 139567630) is 2,3,3-trifluoroprop-2-enyl 2-oxo-2-[prop-2-enyl(prop-2-ynyl)amino]acetate.
What is the SMILES notation for 2,3,3-trifluoroprop-2-enyl 2-oxo-2-[prop-2-enyl(prop-2-ynyl)amino]acetate?
The canonical SMILES for 2,3,3-trifluoroprop-2-enyl 2-oxo-2-[prop-2-enyl(prop-2-ynyl)amino]acetate is C#CCN(CC=C)C(=O)C(=O)OCC(F)=C(F)F.
What is the InChIKey of 2,3,3-trifluoroprop-2-enyl 2-oxo-2-[prop-2-enyl(prop-2-ynyl)amino]acetate?
The InChIKey is RQZURASQAGWJPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F3NO3/c1-3-5-15(6-4-2)10(16)11(17)18-7-8(12)9(13)14/h1,4H,2,5-7H2.
What are the key properties of 2,3,3-trifluoroprop-2-enyl 2-oxo-2-[prop-2-enyl(prop-2-ynyl)amino]acetate?
2,3,3-trifluoroprop-2-enyl 2-oxo-2-[prop-2-enyl(prop-2-ynyl)amino]acetate has a molecular weight of 261.20 g/mol, XLogP of 1.25, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,3-trifluoroprop-2-enyl 2-oxo-2-[prop-2-enyl(prop-2-ynyl)amino]acetate is sourced from PubChem (CID 139567630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).