C13H16F5NO3 — CID 139567656
[(E)-2,3,4,4,4-pentafluorobut-2-enyl] 2-[tert-butyl(prop-2-enyl)amino]-2-oxoacetate (PubChem CID 139567656) has the molecular formula C13H16F5NO3 and a molecular weight of 329.27 g/mol. Its IUPAC name is [(E)-2,3,4,4,4-pentafluorobut-2-enyl] 2-[tert-butyl(prop-2-enyl)amino]-2-oxoacetate.
| Compound Name | [(E)-2,3,4,4,4-pentafluorobut-2-enyl] 2-[tert-butyl(prop-2-enyl)amino]-2-oxoacetate |
|---|---|
| PubChem CID | 139567656 |
| Molecular Formula | C13H16F5NO3 |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | [(E)-2,3,4,4,4-pentafluorobut-2-enyl] 2-[tert-butyl(prop-2-enyl)amino]-2-oxoacetate |
| SMILES | C=CCN(C(=O)C(=O)OC/C(F)=C(\F)C(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C13H16F5NO3/c1-5-6-19(12(2,3)4)10(20)11(21)22-7-8(14)9(15)13(16,17)18/h5H,1,6-7H2,2-4H3/b9-8+ |
| InChIKey | YRKOLVWSMRBCOY-CMDGGOBGSA-N |
| XLogP | 3.06 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|