C10H8F3NO3 — CID 139567701
4,4,4-trifluorobut-2-ynyl 2-(2,5-dihydropyrrol-1-yl)-2-oxoacetate (PubChem CID 139567701) has the molecular formula C10H8F3NO3 and a molecular weight of 247.17 g/mol. Its IUPAC name is 4,4,4-trifluorobut-2-ynyl 2-(2,5-dihydropyrrol-1-yl)-2-oxoacetate.
| Compound Name | 4,4,4-trifluorobut-2-ynyl 2-(2,5-dihydropyrrol-1-yl)-2-oxoacetate |
|---|---|
| PubChem CID | 139567701 |
| Molecular Formula | C10H8F3NO3 |
| Molecular Weight | 247.17 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 4,4,4-trifluorobut-2-ynyl 2-(2,5-dihydropyrrol-1-yl)-2-oxoacetate |
| SMILES | O=C(OCC#CC(F)(F)F)C(=O)N1CC=CC1 |
| InChI | InChI=1S/C10H8F3NO3/c11-10(12,13)4-3-7-17-9(16)8(15)14-5-1-2-6-14/h1-2H,5-7H2 |
| InChIKey | MOYPVNRQZXFRIV-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.17 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|