About 4,4,4-trifluorobut-2-ynyl 2-oxo-2-[prop-2-enyl(prop-2-ynyl)amino]acetate
4,4,4-trifluorobut-2-ynyl 2-oxo-2-[prop-2-enyl(prop-2-ynyl)amino]acetate (PubChem CID 139567703) has the molecular formula C12H10F3NO3
and a molecular weight of 273.21 g/mol. Its IUPAC name is 4,4,4-trifluorobut-2-ynyl 2-oxo-2-[prop-2-enyl(prop-2-ynyl)amino]acetate.
Molecular Properties
| Compound Name | 4,4,4-trifluorobut-2-ynyl 2-oxo-2-[prop-2-enyl(prop-2-ynyl)amino]acetate |
| PubChem CID | 139567703 |
| Molecular Formula | C12H10F3NO3 |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 4,4,4-trifluorobut-2-ynyl 2-oxo-2-[prop-2-enyl(prop-2-ynyl)amino]acetate |
| SMILES | C#CCN(CC=C)C(=O)C(=O)OCC#CC(F)(F)F |
| InChI | InChI=1S/C12H10F3NO3/c1-3-7-16(8-4-2)10(17)11(18)19-9-5-6-12(13,14)15/h1,4H,2,7-9H2 |
| InChIKey | SLEBDJHGURVYIH-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4,4,4-trifluorobut-2-ynyl 2-oxo-2-[prop-2-enyl(prop-2-ynyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4,4-trifluorobut-2-ynyl 2-oxo-2-[prop-2-enyl(prop-2-ynyl)amino]acetate?
The IUPAC name of 4,4,4-trifluorobut-2-ynyl 2-oxo-2-[prop-2-enyl(prop-2-ynyl)amino]acetate (CID 139567703) is 4,4,4-trifluorobut-2-ynyl 2-oxo-2-[prop-2-enyl(prop-2-ynyl)amino]acetate.
What is the SMILES notation for 4,4,4-trifluorobut-2-ynyl 2-oxo-2-[prop-2-enyl(prop-2-ynyl)amino]acetate?
The canonical SMILES for 4,4,4-trifluorobut-2-ynyl 2-oxo-2-[prop-2-enyl(prop-2-ynyl)amino]acetate is C#CCN(CC=C)C(=O)C(=O)OCC#CC(F)(F)F.
What is the InChIKey of 4,4,4-trifluorobut-2-ynyl 2-oxo-2-[prop-2-enyl(prop-2-ynyl)amino]acetate?
The InChIKey is SLEBDJHGURVYIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F3NO3/c1-3-7-16(8-4-2)10(17)11(18)19-9-5-6-12(13,14)15/h1,4H,2,7-9H2.
What are the key properties of 4,4,4-trifluorobut-2-ynyl 2-oxo-2-[prop-2-enyl(prop-2-ynyl)amino]acetate?
4,4,4-trifluorobut-2-ynyl 2-oxo-2-[prop-2-enyl(prop-2-ynyl)amino]acetate has a molecular weight of 273.21 g/mol, XLogP of 0.74, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4,4-trifluorobut-2-ynyl 2-oxo-2-[prop-2-enyl(prop-2-ynyl)amino]acetate is sourced from PubChem (CID 139567703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).