C13H10ClF3N2O3S — CID 139568668
4-[[5-[2-chloro-4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]sulfanyl]butanoic acid (PubChem CID 139568668) has the molecular formula C13H10ClF3N2O3S and a molecular weight of 366.75 g/mol. Its IUPAC name is 4-[[5-[2-chloro-4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]sulfanyl]butanoic acid.
| Compound Name | 4-[[5-[2-chloro-4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]sulfanyl]butanoic acid |
|---|---|
| PubChem CID | 139568668 |
| Molecular Formula | C13H10ClF3N2O3S |
| Molecular Weight | 366.75 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | 4-[[5-[2-chloro-4-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]sulfanyl]butanoic acid |
| SMILES | O=C(O)CCCSc1nnc(-c2ccc(C(F)(F)F)cc2Cl)o1 |
| InChI | InChI=1S/C13H10ClF3N2O3S/c14-9-6-7(13(15,16)17)3-4-8(9)11-18-19-12(22-11)23-5-1-2-10(20)21/h3-4,6H,1-2,5H2,(H,20,21) |
| InChIKey | RITYGMZELNDNTA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.75 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|