C15H24N4 — CID 139568975
(2S)-3-(4-amino-3-methanimidoylphenyl)-2-N-(cyclopropylmethyl)-2-N-methylpropane-1,2-diamine (PubChem CID 139568975) has the molecular formula C15H24N4 and a molecular weight of 260.38 g/mol. Its IUPAC name is (2S)-3-(4-amino-3-methanimidoylphenyl)-2-N-(cyclopropylmethyl)-2-N-methylpropane-1,2-diamine.
| Compound Name | (2S)-3-(4-amino-3-methanimidoylphenyl)-2-N-(cyclopropylmethyl)-2-N-methylpropane-1,2-diamine |
|---|---|
| PubChem CID | 139568975 |
| Molecular Formula | C15H24N4 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | (2S)-3-(4-amino-3-methanimidoylphenyl)-2-N-(cyclopropylmethyl)-2-N-methylpropane-1,2-diamine |
| SMILES | [H]/N=C/c1cc(C[C@@H](CN)N(C)CC2CC2)ccc1N |
| InChI | InChI=1S/C15H24N4/c1-19(10-11-2-3-11)14(9-17)7-12-4-5-15(18)13(6-12)8-16/h4-6,8,11,14,16H,2-3,7,9-10,17-18H2,1H3/b16-8+/t14-/m0/s1 |
| InChIKey | FPELRULSHSKEOA-BRSWLGOBSA-N |
| XLogP | 1.48 |
| TPSA | 79.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|