C25H23N5O4S — CID 139569109
2-[(2S)-3-[1-(benzenesulfonyl)pyrazolo[3,4-c]pyridin-5-yl]-2-(dimethylamino)propyl]isoindole-1,3-dione (PubChem CID 139569109) has the molecular formula C25H23N5O4S and a molecular weight of 489.56 g/mol. Its IUPAC name is 2-[(2S)-3-[1-(benzenesulfonyl)pyrazolo[3,4-c]pyridin-5-yl]-2-(dimethylamino)propyl]isoindole-1,3-dione.
| Compound Name | 2-[(2S)-3-[1-(benzenesulfonyl)pyrazolo[3,4-c]pyridin-5-yl]-2-(dimethylamino)propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 139569109 |
| Molecular Formula | C25H23N5O4S |
| Molecular Weight | 489.56 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | 2-[(2S)-3-[1-(benzenesulfonyl)pyrazolo[3,4-c]pyridin-5-yl]-2-(dimethylamino)propyl]isoindole-1,3-dione |
| SMILES | CN(C)[C@@H](Cc1cc2cnn(S(=O)(=O)c3ccccc3)c2cn1)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H23N5O4S/c1-28(2)19(16-29-24(31)21-10-6-7-11-22(21)25(29)32)13-18-12-17-14-27-30(23(17)15-26-18)35(33,34)20-8-4-3-5-9-20/h3-12,14-15,19H,13,16H2,1-2H3/t19-/m0/s1 |
| InChIKey | VOHHOFYIGNLDSV-IBGZPJMESA-N |
| XLogP | 2.44 |
| TPSA | 105.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.56 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|