C37H67NO6 — CID 139570158
(Z)-2-[2-[[(Z)-3-carboxypentadec-10-enyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]tetradec-9-enoic acid (PubChem CID 139570158) has the molecular formula C37H67NO6 and a molecular weight of 621.94 g/mol. Its IUPAC name is (Z)-2-[2-[[(Z)-3-carboxypentadec-10-enyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]tetradec-9-enoic acid.
| Compound Name | (Z)-2-[2-[[(Z)-3-carboxypentadec-10-enyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]tetradec-9-enoic acid |
|---|---|
| PubChem CID | 139570158 |
| Molecular Formula | C37H67NO6 |
| Molecular Weight | 621.94 g/mol |
| Exact Mass | 621.50 |
| IUPAC Name | (Z)-2-[2-[[(Z)-3-carboxypentadec-10-enyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]tetradec-9-enoic acid |
| SMILES | CCCC/C=C\CCCCCCC(CCN(CCC(CCCCCC/C=C\CCCC)C(=O)O)C(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C37H67NO6/c1-6-8-10-12-14-16-18-20-22-24-26-32(34(39)40)28-30-38(36(43)44-37(3,4)5)31-29-33(35(41)42)27-25-23-21-19-17-15-13-11-9-7-2/h12-15,32-33H,6-11,16-31H2,1-5H3,(H,39,40)(H,41,42)/b14-12-,15-13- |
| InChIKey | XHDZPKICEDHFID-DZDAAMPGSA-N |
| XLogP | 10.58 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.94 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|