About 3-ethyl-7,7,7-trifluoro-6-methyl-2-prop-1-en-2-yloxyhept-1-ene
3-ethyl-7,7,7-trifluoro-6-methyl-2-prop-1-en-2-yloxyhept-1-ene (PubChem CID 139572162) has the molecular formula C13H21F3O
and a molecular weight of 250.30 g/mol. Its IUPAC name is 3-ethyl-7,7,7-trifluoro-6-methyl-2-prop-1-en-2-yloxyhept-1-ene.
Molecular Properties
| Compound Name | 3-ethyl-7,7,7-trifluoro-6-methyl-2-prop-1-en-2-yloxyhept-1-ene |
| PubChem CID | 139572162 |
| Molecular Formula | C13H21F3O |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 3-ethyl-7,7,7-trifluoro-6-methyl-2-prop-1-en-2-yloxyhept-1-ene |
| SMILES | C=C(C)OC(=C)C(CC)CCC(C)C(F)(F)F |
| InChI | InChI=1S/C13H21F3O/c1-6-12(11(5)17-9(2)3)8-7-10(4)13(14,15)16/h10,12H,2,5-8H2,1,3-4H3 |
| InChIKey | VNIHRWCIVKASHM-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-7,7,7-trifluoro-6-methyl-2-prop-1-en-2-yloxyhept-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-7,7,7-trifluoro-6-methyl-2-prop-1-en-2-yloxyhept-1-ene?
The IUPAC name of 3-ethyl-7,7,7-trifluoro-6-methyl-2-prop-1-en-2-yloxyhept-1-ene (CID 139572162) is 3-ethyl-7,7,7-trifluoro-6-methyl-2-prop-1-en-2-yloxyhept-1-ene.
What is the SMILES notation for 3-ethyl-7,7,7-trifluoro-6-methyl-2-prop-1-en-2-yloxyhept-1-ene?
The canonical SMILES for 3-ethyl-7,7,7-trifluoro-6-methyl-2-prop-1-en-2-yloxyhept-1-ene is C=C(C)OC(=C)C(CC)CCC(C)C(F)(F)F.
What is the InChIKey of 3-ethyl-7,7,7-trifluoro-6-methyl-2-prop-1-en-2-yloxyhept-1-ene?
The InChIKey is VNIHRWCIVKASHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21F3O/c1-6-12(11(5)17-9(2)3)8-7-10(4)13(14,15)16/h10,12H,2,5-8H2,1,3-4H3.
What are the key properties of 3-ethyl-7,7,7-trifluoro-6-methyl-2-prop-1-en-2-yloxyhept-1-ene?
3-ethyl-7,7,7-trifluoro-6-methyl-2-prop-1-en-2-yloxyhept-1-ene has a molecular weight of 250.30 g/mol, XLogP of 5.06, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-7,7,7-trifluoro-6-methyl-2-prop-1-en-2-yloxyhept-1-ene is sourced from PubChem (CID 139572162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).