C11H17NO — CID 139572171
(3Z,5Z)-3-[[(E)-but-2-en-2-yl]amino]hepta-1,3,5-trien-4-ol (PubChem CID 139572171) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is (3Z,5Z)-3-[[(E)-but-2-en-2-yl]amino]hepta-1,3,5-trien-4-ol.
| Compound Name | (3Z,5Z)-3-[[(E)-but-2-en-2-yl]amino]hepta-1,3,5-trien-4-ol |
|---|---|
| PubChem CID | 139572171 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | (3Z,5Z)-3-[[(E)-but-2-en-2-yl]amino]hepta-1,3,5-trien-4-ol |
| SMILES | C=C/C(N/C(C)=C/C)=C(O)\C=C/C |
| InChI | InChI=1S/C11H17NO/c1-5-8-11(13)10(7-3)12-9(4)6-2/h5-8,12-13H,3H2,1-2,4H3/b8-5-,9-6+,11-10- |
| InChIKey | FNMAILROUIGRSD-FKWPDEHMSA-N |
| XLogP | 3.03 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|