About 2-(2,3,5-trifluorophenyl)cyclohexan-1-ol
2-(2,3,5-trifluorophenyl)cyclohexan-1-ol (PubChem CID 139573219) has the molecular formula C12H13F3O
and a molecular weight of 230.23 g/mol. Its IUPAC name is 2-(2,3,5-trifluorophenyl)cyclohexan-1-ol.
Molecular Properties
| Compound Name | 2-(2,3,5-trifluorophenyl)cyclohexan-1-ol |
| PubChem CID | 139573219 |
| Molecular Formula | C12H13F3O |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 2-(2,3,5-trifluorophenyl)cyclohexan-1-ol |
| SMILES | OC1CCCCC1c1cc(F)cc(F)c1F |
| InChI | InChI=1S/C12H13F3O/c13-7-5-9(12(15)10(14)6-7)8-3-1-2-4-11(8)16/h5-6,8,11,16H,1-4H2 |
| InChIKey | CCRIRYUBLZEFMU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,3,5-trifluorophenyl)cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3,5-trifluorophenyl)cyclohexan-1-ol?
The IUPAC name of 2-(2,3,5-trifluorophenyl)cyclohexan-1-ol (CID 139573219) is 2-(2,3,5-trifluorophenyl)cyclohexan-1-ol.
What is the SMILES notation for 2-(2,3,5-trifluorophenyl)cyclohexan-1-ol?
The canonical SMILES for 2-(2,3,5-trifluorophenyl)cyclohexan-1-ol is OC1CCCCC1c1cc(F)cc(F)c1F.
What is the InChIKey of 2-(2,3,5-trifluorophenyl)cyclohexan-1-ol?
The InChIKey is CCRIRYUBLZEFMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F3O/c13-7-5-9(12(15)10(14)6-7)8-3-1-2-4-11(8)16/h5-6,8,11,16H,1-4H2.
What are the key properties of 2-(2,3,5-trifluorophenyl)cyclohexan-1-ol?
2-(2,3,5-trifluorophenyl)cyclohexan-1-ol has a molecular weight of 230.23 g/mol, XLogP of 3.12, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3,5-trifluorophenyl)cyclohexan-1-ol is sourced from PubChem (CID 139573219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).