C72H65N3 — CID 139573299
3-N,8-N-bis(4-tert-butylphenyl)-3-N,8-N-bis(9,9-dimethylfluoren-2-yl)-5-phenylbenzo[b]carbazole-3,8-diamine (PubChem CID 139573299) has the molecular formula C72H65N3 and a molecular weight of 972.33 g/mol. Its IUPAC name is 3-N,8-N-bis(4-tert-butylphenyl)-3-N,8-N-bis(9,9-dimethylfluoren-2-yl)-5-phenylbenzo[b]carbazole-3,8-diamine.
| Compound Name | 3-N,8-N-bis(4-tert-butylphenyl)-3-N,8-N-bis(9,9-dimethylfluoren-2-yl)-5-phenylbenzo[b]carbazole-3,8-diamine |
|---|---|
| PubChem CID | 139573299 |
| Molecular Formula | C72H65N3 |
| Molecular Weight | 972.33 g/mol |
| Exact Mass | 971.52 |
| IUPAC Name | 3-N,8-N-bis(4-tert-butylphenyl)-3-N,8-N-bis(9,9-dimethylfluoren-2-yl)-5-phenylbenzo[b]carbazole-3,8-diamine |
| SMILES | CC(C)(C)c1ccc(N(c2ccc3c(c2)C(C)(C)c2ccccc2-3)c2ccc3cc4c5ccc(N(c6ccc(C(C)(C)C)cc6)c6ccc7c(c6)C(C)(C)c6ccccc6-7)cc5n(-c5ccccc5)c4cc3c2)cc1 |
| InChI | InChI=1S/C72H65N3/c1-69(2,3)48-25-30-51(31-26-48)73(54-34-37-59-57-20-14-16-22-63(57)71(7,8)65(59)43-54)53-29-24-46-41-62-61-39-36-56(45-68(61)75(50-18-12-11-13-19-50)67(62)42-47(46)40-53)74(52-32-27-49(28-33-52)70(4,5)6)55-35-38-60-58-21-15-17-23-64(58)72(9,10)66(60)44-55/h11-45H,1-10H3 |
| InChIKey | OFGNASHPZLMXIS-UHFFFAOYSA-N |
| XLogP | 20.08 |
| TPSA | 11.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 972.33 |
| LogP ≤ 5 | 20.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |