C27H31FIN5O2S2 — CID 139574081
[1-[3-[(6-amino-2-pyridinyl)sulfanylcarbamoyl]-6-[3-fluoro-5-(2-methylpropoxy)phenyl]-2-pyridinyl]-5,5-dimethylpyrrolidin-3-yl] thiohypoiodite (PubChem CID 139574081) has the molecular formula C27H31FIN5O2S2 and a molecular weight of 667.61 g/mol. Its IUPAC name is [1-[3-[(6-amino-2-pyridinyl)sulfanylcarbamoyl]-6-[3-fluoro-5-(2-methylpropoxy)phenyl]-2-pyridinyl]-5,5-dimethylpyrrolidin-3-yl] thiohypoiodite.
| Compound Name | [1-[3-[(6-amino-2-pyridinyl)sulfanylcarbamoyl]-6-[3-fluoro-5-(2-methylpropoxy)phenyl]-2-pyridinyl]-5,5-dimethylpyrrolidin-3-yl] thiohypoiodite |
|---|---|
| PubChem CID | 139574081 |
| Molecular Formula | C27H31FIN5O2S2 |
| Molecular Weight | 667.61 g/mol |
| Exact Mass | 667.09 |
| IUPAC Name | [1-[3-[(6-amino-2-pyridinyl)sulfanylcarbamoyl]-6-[3-fluoro-5-(2-methylpropoxy)phenyl]-2-pyridinyl]-5,5-dimethylpyrrolidin-3-yl] thiohypoiodite |
| SMILES | CC(C)COc1cc(F)cc(-c2ccc(C(=O)NSc3cccc(N)n3)c(N3CC(SI)CC3(C)C)n2)c1 |
| InChI | InChI=1S/C27H31FIN5O2S2/c1-16(2)15-36-19-11-17(10-18(28)12-19)22-9-8-21(26(35)33-38-24-7-5-6-23(30)32-24)25(31-22)34-14-20(37-29)13-27(34,3)4/h5-12,16,20H,13-15H2,1-4H3,(H2,30,32)(H,33,35) |
| InChIKey | BTSNAEUDLXBGKM-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.61 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|