C11H6N2S — CID 139574579
8-thia-10,14-diazatricyclo[7.5.0.02,7]tetradeca-1(14),2,4,6,9,11,12-heptaene (PubChem CID 139574579) has the molecular formula C11H6N2S and a molecular weight of 198.25 g/mol. Its IUPAC name is 8-thia-10,14-diazatricyclo[7.5.0.02,7]tetradeca-1(14),2,4,6,9,11,12-heptaene.
| Compound Name | 8-thia-10,14-diazatricyclo[7.5.0.02,7]tetradeca-1(14),2,4,6,9,11,12-heptaene |
|---|---|
| PubChem CID | 139574579 |
| Molecular Formula | C11H6N2S |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.03 |
| IUPAC Name | 8-thia-10,14-diazatricyclo[7.5.0.02,7]tetradeca-1(14),2,4,6,9,11,12-heptaene |
| SMILES | C1=CN=c2sc3ccccc3c2=NC=1 |
| InChI | InChI=1S/C11H6N2S/c1-2-5-9-8(4-1)10-11(14-9)13-7-3-6-12-10/h1-2,4-7H |
| InChIKey | JPLAEJRYQROOQN-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |