C61H50N2O3 — CID 139574656
3-N,8-N-bis(4-tert-butylphenyl)-3-N,8-N-di(dibenzofuran-3-yl)-4-methylnaphtho[3,2-b][1]benzofuran-3,8-diamine (PubChem CID 139574656) has the molecular formula C61H50N2O3 and a molecular weight of 859.08 g/mol. Its IUPAC name is 3-N,8-N-bis(4-tert-butylphenyl)-3-N,8-N-di(dibenzofuran-3-yl)-4-methylnaphtho[3,2-b][1]benzofuran-3,8-diamine.
| Compound Name | 3-N,8-N-bis(4-tert-butylphenyl)-3-N,8-N-di(dibenzofuran-3-yl)-4-methylnaphtho[3,2-b][1]benzofuran-3,8-diamine |
|---|---|
| PubChem CID | 139574656 |
| Molecular Formula | C61H50N2O3 |
| Molecular Weight | 859.08 g/mol |
| Exact Mass | 858.38 |
| IUPAC Name | 3-N,8-N-bis(4-tert-butylphenyl)-3-N,8-N-di(dibenzofuran-3-yl)-4-methylnaphtho[3,2-b][1]benzofuran-3,8-diamine |
| SMILES | Cc1c(N(c2ccc(C(C)(C)C)cc2)c2ccc3c(c2)oc2ccccc23)ccc2c1oc1cc3cc(N(c4ccc(C(C)(C)C)cc4)c4ccc5c(c4)oc4ccccc45)ccc3cc12 |
| InChI | InChI=1S/C61H50N2O3/c1-37-53(63(43-24-19-41(20-25-43)61(5,6)7)46-27-29-50-48-13-9-11-15-55(48)65-58(50)36-46)31-30-51-52-33-38-16-21-44(32-39(38)34-56(52)66-59(37)51)62(42-22-17-40(18-23-42)60(2,3)4)45-26-28-49-47-12-8-10-14-54(47)64-57(49)35-45/h8-36H,1-7H3 |
| InChIKey | GOAJCVMWWOBAPP-UHFFFAOYSA-N |
| XLogP | 18.38 |
| TPSA | 45.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.08 |
| LogP ≤ 5 | 18.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |