C7H13N3O3 — CID 139575508
(2S,3S,4R,6R)-2-(azidomethyl)-6-methyloxane-3,4-diol (PubChem CID 139575508) has the molecular formula C7H13N3O3 and a molecular weight of 187.20 g/mol. Its IUPAC name is (2S,3S,4R,6R)-2-(azidomethyl)-6-methyloxane-3,4-diol.
| Compound Name | (2S,3S,4R,6R)-2-(azidomethyl)-6-methyloxane-3,4-diol |
|---|---|
| PubChem CID | 139575508 |
| Molecular Formula | C7H13N3O3 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | (2S,3S,4R,6R)-2-(azidomethyl)-6-methyloxane-3,4-diol |
| SMILES | C[C@@H]1C[C@@H](O)[C@H](O)[C@H](CN=[N+]=[N-])O1 |
| InChI | InChI=1S/C7H13N3O3/c1-4-2-5(11)7(12)6(13-4)3-9-10-8/h4-7,11-12H,2-3H2,1H3/t4-,5-,6+,7+/m1/s1 |
| InChIKey | HHBYXCSZFHNPQQ-JWXFUTCRSA-N |
| XLogP | 0.20 |
| TPSA | 98.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|