C20H22FN3O3S — CID 139575684
[(2R,3R,4R,6S)-5-azido-4-fluoro-6-(4-methylphenyl)sulfanyl-3-phenylmethoxyoxan-2-yl]methanol (PubChem CID 139575684) has the molecular formula C20H22FN3O3S and a molecular weight of 403.48 g/mol. Its IUPAC name is [(2R,3R,4R,6S)-5-azido-4-fluoro-6-(4-methylphenyl)sulfanyl-3-phenylmethoxyoxan-2-yl]methanol.
| Compound Name | [(2R,3R,4R,6S)-5-azido-4-fluoro-6-(4-methylphenyl)sulfanyl-3-phenylmethoxyoxan-2-yl]methanol |
|---|---|
| PubChem CID | 139575684 |
| Molecular Formula | C20H22FN3O3S |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | [(2R,3R,4R,6S)-5-azido-4-fluoro-6-(4-methylphenyl)sulfanyl-3-phenylmethoxyoxan-2-yl]methanol |
| SMILES | Cc1ccc(S[C@@H]2O[C@H](CO)[C@@H](OCc3ccccc3)[C@H](F)C2N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C20H22FN3O3S/c1-13-7-9-15(10-8-13)28-20-18(23-24-22)17(21)19(16(11-25)27-20)26-12-14-5-3-2-4-6-14/h2-10,16-20,25H,11-12H2,1H3/t16-,17-,18?,19-,20+/m1/s1 |
| InChIKey | XGERECOLNAFSOY-KGEPEWOVSA-N |
| XLogP | 4.41 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|