About N-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]buta-1,3-dien-2-amine
N-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]buta-1,3-dien-2-amine (PubChem CID 139575722) has the molecular formula C11H14FN
and a molecular weight of 179.24 g/mol. Its IUPAC name is N-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]buta-1,3-dien-2-amine.
Molecular Properties
| Compound Name | N-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]buta-1,3-dien-2-amine |
| PubChem CID | 139575722 |
| Molecular Formula | C11H14FN |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | N-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]buta-1,3-dien-2-amine |
| SMILES | C=CC(=C)NCC1=CCC(F)C=C1 |
| InChI | InChI=1S/C11H14FN/c1-3-9(2)13-8-10-4-6-11(12)7-5-10/h3-6,11,13H,1-2,7-8H2 |
| InChIKey | FJRIQAKOSFBYNQ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]buta-1,3-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]buta-1,3-dien-2-amine?
The IUPAC name of N-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]buta-1,3-dien-2-amine (CID 139575722) is N-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]buta-1,3-dien-2-amine.
What is the SMILES notation for N-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]buta-1,3-dien-2-amine?
The canonical SMILES for N-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]buta-1,3-dien-2-amine is C=CC(=C)NCC1=CCC(F)C=C1.
What is the InChIKey of N-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]buta-1,3-dien-2-amine?
The InChIKey is FJRIQAKOSFBYNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14FN/c1-3-9(2)13-8-10-4-6-11(12)7-5-10/h3-6,11,13H,1-2,7-8H2.
What are the key properties of N-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]buta-1,3-dien-2-amine?
N-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]buta-1,3-dien-2-amine has a molecular weight of 179.24 g/mol, XLogP of 2.50, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]buta-1,3-dien-2-amine is sourced from PubChem (CID 139575722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).