C29H27F3N6O3 — CID 139575868
2-[[2-[[3-(furan-3-yl)-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl]amino]-5-(trifluoromethyl)-4-pyridinyl]amino]-N-methylbenzamide (PubChem CID 139575868) has the molecular formula C29H27F3N6O3 and a molecular weight of 564.57 g/mol. Its IUPAC name is 2-[[2-[[3-(furan-3-yl)-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl]amino]-5-(trifluoromethyl)-4-pyridinyl]amino]-N-methylbenzamide.
| Compound Name | 2-[[2-[[3-(furan-3-yl)-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl]amino]-5-(trifluoromethyl)-4-pyridinyl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 139575868 |
| Molecular Formula | C29H27F3N6O3 |
| Molecular Weight | 564.57 g/mol |
| Exact Mass | 564.21 |
| IUPAC Name | 2-[[2-[[3-(furan-3-yl)-2,4,4a,5-tetrahydro-1H-pyrazino[2,1-c][1,4]benzoxazin-8-yl]amino]-5-(trifluoromethyl)-4-pyridinyl]amino]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccccc1Nc1cc(Nc2ccc3c(c2)OCC2CN(c4ccoc4)CCN32)ncc1C(F)(F)F |
| InChI | InChI=1S/C29H27F3N6O3/c1-33-28(39)21-4-2-3-5-23(21)36-24-13-27(34-14-22(24)29(30,31)32)35-18-6-7-25-26(12-18)41-17-20-15-37(9-10-38(20)25)19-8-11-40-16-19/h2-8,11-14,16,20H,9-10,15,17H2,1H3,(H,33,39)(H2,34,35,36) |
| InChIKey | WYAJXUAHRODRJR-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 94.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.57 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |