C30H34N4O4 — CID 139575997
tert-butyl N-[[3-[1-[[2-(2-ethoxyethyl)phenyl]carbamoyl]pyrrolo[1,2-a]pyrazin-3-yl]phenyl]methyl]carbamate (PubChem CID 139575997) has the molecular formula C30H34N4O4 and a molecular weight of 514.63 g/mol. Its IUPAC name is tert-butyl N-[[3-[1-[[2-(2-ethoxyethyl)phenyl]carbamoyl]pyrrolo[1,2-a]pyrazin-3-yl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-[1-[[2-(2-ethoxyethyl)phenyl]carbamoyl]pyrrolo[1,2-a]pyrazin-3-yl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 139575997 |
| Molecular Formula | C30H34N4O4 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | tert-butyl N-[[3-[1-[[2-(2-ethoxyethyl)phenyl]carbamoyl]pyrrolo[1,2-a]pyrazin-3-yl]phenyl]methyl]carbamate |
| SMILES | CCOCCc1ccccc1NC(=O)c1nc(-c2cccc(CNC(=O)OC(C)(C)C)c2)cn2cccc12 |
| InChI | InChI=1S/C30H34N4O4/c1-5-37-17-15-22-11-6-7-13-24(22)33-28(35)27-26-14-9-16-34(26)20-25(32-27)23-12-8-10-21(18-23)19-31-29(36)38-30(2,3)4/h6-14,16,18,20H,5,15,17,19H2,1-4H3,(H,31,36)(H,33,35) |
| InChIKey | AHLXDEBTUUIPGL-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|