About azane;2-methylprop-2-enoic acid;prop-2-enoic acid
azane;2-methylprop-2-enoic acid;prop-2-enoic acid (PubChem CID 139577459) has the molecular formula C7H13NO4
and a molecular weight of 175.18 g/mol. Its IUPAC name is azane;2-methylprop-2-enoic acid;prop-2-enoic acid.
Molecular Properties
| Compound Name | azane;2-methylprop-2-enoic acid;prop-2-enoic acid |
| PubChem CID | 139577459 |
| Molecular Formula | C7H13NO4 |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | azane;2-methylprop-2-enoic acid;prop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.C=CC(=O)O.N |
| InChI | InChI=1S/C4H6O2.C3H4O2.H3N/c1-3(2)4(5)6;1-2-3(4)5;/h1H2,2H3,(H,5,6);2H,1H2,(H,4,5);1H3 |
| InChIKey | PGILNAFSVPYISH-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 109.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze azane;2-methylprop-2-enoic acid;prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-methylprop-2-enoic acid;prop-2-enoic acid?
The IUPAC name of azane;2-methylprop-2-enoic acid;prop-2-enoic acid (CID 139577459) is azane;2-methylprop-2-enoic acid;prop-2-enoic acid.
What is the SMILES notation for azane;2-methylprop-2-enoic acid;prop-2-enoic acid?
The canonical SMILES for azane;2-methylprop-2-enoic acid;prop-2-enoic acid is C=C(C)C(=O)O.C=CC(=O)O.N.
What is the InChIKey of azane;2-methylprop-2-enoic acid;prop-2-enoic acid?
The InChIKey is PGILNAFSVPYISH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2.C3H4O2.H3N/c1-3(2)4(5)6;1-2-3(4)5;/h1H2,2H3,(H,5,6);2H,1H2,(H,4,5);1H3.
What are the key properties of azane;2-methylprop-2-enoic acid;prop-2-enoic acid?
azane;2-methylprop-2-enoic acid;prop-2-enoic acid has a molecular weight of 175.18 g/mol, XLogP of 1.07, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-methylprop-2-enoic acid;prop-2-enoic acid is sourced from PubChem (CID 139577459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).