C20H20N4O5 — CID 139577482
N,3-dihydroxy-2-methyl-3-(5-methyl-1,2-oxazol-3-yl)-2-[[5-(2-phenylethynyl)-1,2-oxazol-3-yl]methylamino]propanamide (PubChem CID 139577482) has the molecular formula C20H20N4O5 and a molecular weight of 396.40 g/mol. Its IUPAC name is N,3-dihydroxy-2-methyl-3-(5-methyl-1,2-oxazol-3-yl)-2-[[5-(2-phenylethynyl)-1,2-oxazol-3-yl]methylamino]propanamide.
| Compound Name | N,3-dihydroxy-2-methyl-3-(5-methyl-1,2-oxazol-3-yl)-2-[[5-(2-phenylethynyl)-1,2-oxazol-3-yl]methylamino]propanamide |
|---|---|
| PubChem CID | 139577482 |
| Molecular Formula | C20H20N4O5 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | N,3-dihydroxy-2-methyl-3-(5-methyl-1,2-oxazol-3-yl)-2-[[5-(2-phenylethynyl)-1,2-oxazol-3-yl]methylamino]propanamide |
| SMILES | Cc1cc(C(O)C(C)(NCc2cc(C#Cc3ccccc3)on2)C(=O)NO)no1 |
| InChI | InChI=1S/C20H20N4O5/c1-13-10-17(24-28-13)18(25)20(2,19(26)22-27)21-12-15-11-16(29-23-15)9-8-14-6-4-3-5-7-14/h3-7,10-11,18,21,25,27H,12H2,1-2H3,(H,22,26) |
| InChIKey | FCSYHENVRAZNIS-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 133.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|