About 2-methyl-4-(2,2,3-trimethylcyclopentyl)butan-1-ol;1-(4-propan-2-ylcyclohexyl)ethanol
2-methyl-4-(2,2,3-trimethylcyclopentyl)butan-1-ol;1-(4-propan-2-ylcyclohexyl)ethanol (PubChem CID 139577549) has the molecular formula C24H48O2
and a molecular weight of 368.65 g/mol. Its IUPAC name is 2-methyl-4-(2,2,3-trimethylcyclopentyl)butan-1-ol;1-(4-propan-2-ylcyclohexyl)ethanol.
Molecular Properties
| Compound Name | 2-methyl-4-(2,2,3-trimethylcyclopentyl)butan-1-ol;1-(4-propan-2-ylcyclohexyl)ethanol |
| PubChem CID | 139577549 |
| Molecular Formula | C24H48O2 |
| Molecular Weight | 368.65 g/mol |
| Exact Mass | 368.37 |
| IUPAC Name | 2-methyl-4-(2,2,3-trimethylcyclopentyl)butan-1-ol;1-(4-propan-2-ylcyclohexyl)ethanol |
| SMILES | CC(C)C1CCC(C(C)O)CC1.CC(CO)CCC1CCC(C)C1(C)C |
| InChI | InChI=1S/C13H26O.C11H22O/c1-10(9-14)5-7-12-8-6-11(2)13(12,3)4;1-8(2)10-4-6-11(7-5-10)9(3)12/h10-12,14H,5-9H2,1-4H3;8-12H,4-7H2,1-3H3 |
| InChIKey | WWJHQSQTAYMPMO-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.65 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-4-(2,2,3-trimethylcyclopentyl)butan-1-ol;1-(4-propan-2-ylcyclohexyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-(2,2,3-trimethylcyclopentyl)butan-1-ol;1-(4-propan-2-ylcyclohexyl)ethanol?
The IUPAC name of 2-methyl-4-(2,2,3-trimethylcyclopentyl)butan-1-ol;1-(4-propan-2-ylcyclohexyl)ethanol (CID 139577549) is 2-methyl-4-(2,2,3-trimethylcyclopentyl)butan-1-ol;1-(4-propan-2-ylcyclohexyl)ethanol.
What is the SMILES notation for 2-methyl-4-(2,2,3-trimethylcyclopentyl)butan-1-ol;1-(4-propan-2-ylcyclohexyl)ethanol?
The canonical SMILES for 2-methyl-4-(2,2,3-trimethylcyclopentyl)butan-1-ol;1-(4-propan-2-ylcyclohexyl)ethanol is CC(C)C1CCC(C(C)O)CC1.CC(CO)CCC1CCC(C)C1(C)C.
What is the InChIKey of 2-methyl-4-(2,2,3-trimethylcyclopentyl)butan-1-ol;1-(4-propan-2-ylcyclohexyl)ethanol?
The InChIKey is WWJHQSQTAYMPMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O.C11H22O/c1-10(9-14)5-7-12-8-6-11(2)13(12,3)4;1-8(2)10-4-6-11(7-5-10)9(3)12/h10-12,14H,5-9H2,1-4H3;8-12H,4-7H2,1-3H3.
What are the key properties of 2-methyl-4-(2,2,3-trimethylcyclopentyl)butan-1-ol;1-(4-propan-2-ylcyclohexyl)ethanol?
2-methyl-4-(2,2,3-trimethylcyclopentyl)butan-1-ol;1-(4-propan-2-ylcyclohexyl)ethanol has a molecular weight of 368.65 g/mol, XLogP of 6.30, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-(2,2,3-trimethylcyclopentyl)butan-1-ol;1-(4-propan-2-ylcyclohexyl)ethanol is sourced from PubChem (CID 139577549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).