About (2S,4R)-2,4-bis(hydroxymethyl)azetidine-1-carboxylic acid
(2S,4R)-2,4-bis(hydroxymethyl)azetidine-1-carboxylic acid (PubChem CID 139578433) has the molecular formula C6H11NO4
and a molecular weight of 161.16 g/mol. Its IUPAC name is (2S,4R)-2,4-bis(hydroxymethyl)azetidine-1-carboxylic acid.
Analyze (2S,4R)-2,4-bis(hydroxymethyl)azetidine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4R)-2,4-bis(hydroxymethyl)azetidine-1-carboxylic acid?
The IUPAC name of (2S,4R)-2,4-bis(hydroxymethyl)azetidine-1-carboxylic acid (CID 139578433) is (2S,4R)-2,4-bis(hydroxymethyl)azetidine-1-carboxylic acid.
What is the SMILES notation for (2S,4R)-2,4-bis(hydroxymethyl)azetidine-1-carboxylic acid?
The canonical SMILES for (2S,4R)-2,4-bis(hydroxymethyl)azetidine-1-carboxylic acid is O=C(O)N1[C@H](CO)C[C@@H]1CO.
What is the InChIKey of (2S,4R)-2,4-bis(hydroxymethyl)azetidine-1-carboxylic acid?
The InChIKey is SZEHHGHEFKFDOJ-SYDPRGILSA-N. The full InChI is InChI=1S/C6H11NO4/c8-2-4-1-5(3-9)7(4)6(10)11/h4-5,8-9H,1-3H2,(H,10,11)/t4-,5+.
What are the key properties of (2S,4R)-2,4-bis(hydroxymethyl)azetidine-1-carboxylic acid?
(2S,4R)-2,4-bis(hydroxymethyl)azetidine-1-carboxylic acid has a molecular weight of 161.16 g/mol, XLogP of -0.91, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4R)-2,4-bis(hydroxymethyl)azetidine-1-carboxylic acid is sourced from PubChem (CID 139578433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).