(2S,4R)-2,4-bis(hydroxymethyl)azetidine-1-carboxylic acid

C6H11NO4 — CID 139578433

IUPAC(2S,4R)-2,4-bis(hydroxymethyl)azetidine-1-carboxylic acid
SMILESO=C(O)N1[C@H](CO)C[C@@H]1CO
InChIInChI=1S/C6H11NO4/c8-2-4-1-5(3-9)7(4)6(10)11/h4-5,8-9H,1-3H2,(H,10,11)/t4-,5+
InChIKeySZEHHGHEFKFDOJ-SYDPRGILSA-N
MW161.16 g/mol
LogP-0.91
Rot. Bonds2

About (2S,4R)-2,4-bis(hydroxymethyl)azetidine-1-carboxylic acid

(2S,4R)-2,4-bis(hydroxymethyl)azetidine-1-carboxylic acid (PubChem CID 139578433) has the molecular formula C6H11NO4 and a molecular weight of 161.16 g/mol. Its IUPAC name is (2S,4R)-2,4-bis(hydroxymethyl)azetidine-1-carboxylic acid.

Molecular Properties

Compound Name(2S,4R)-2,4-bis(hydroxymethyl)azetidine-1-carboxylic acid
PubChem CID139578433
Molecular FormulaC6H11NO4
Molecular Weight161.16 g/mol
Exact Mass161.07
IUPAC Name(2S,4R)-2,4-bis(hydroxymethyl)azetidine-1-carboxylic acid
SMILESO=C(O)N1[C@H](CO)C[C@@H]1CO
InChIInChI=1S/C6H11NO4/c8-2-4-1-5(3-9)7(4)6(10)11/h4-5,8-9H,1-3H2,(H,10,11)/t4-,5+
InChIKeySZEHHGHEFKFDOJ-SYDPRGILSA-N
XLogP-0.91
TPSA81.00 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500161.16
LogP ≤ 5-0.91
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze (2S,4R)-2,4-bis(hydroxymethyl)azetidine-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S,4R)-2,4-bis(hydroxymethyl)azetidine-1-carboxylic acid?
The IUPAC name of (2S,4R)-2,4-bis(hydroxymethyl)azetidine-1-carboxylic acid (CID 139578433) is (2S,4R)-2,4-bis(hydroxymethyl)azetidine-1-carboxylic acid.
What is the SMILES notation for (2S,4R)-2,4-bis(hydroxymethyl)azetidine-1-carboxylic acid?
The canonical SMILES for (2S,4R)-2,4-bis(hydroxymethyl)azetidine-1-carboxylic acid is O=C(O)N1[C@H](CO)C[C@@H]1CO.
What is the InChIKey of (2S,4R)-2,4-bis(hydroxymethyl)azetidine-1-carboxylic acid?
The InChIKey is SZEHHGHEFKFDOJ-SYDPRGILSA-N. The full InChI is InChI=1S/C6H11NO4/c8-2-4-1-5(3-9)7(4)6(10)11/h4-5,8-9H,1-3H2,(H,10,11)/t4-,5+.
What are the key properties of (2S,4R)-2,4-bis(hydroxymethyl)azetidine-1-carboxylic acid?
(2S,4R)-2,4-bis(hydroxymethyl)azetidine-1-carboxylic acid has a molecular weight of 161.16 g/mol, XLogP of -0.91, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4R)-2,4-bis(hydroxymethyl)azetidine-1-carboxylic acid is sourced from PubChem (CID 139578433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).