C19H23N5O2 — CID 139580302
8-oxa-2-azaspiro[4.5]decan-2-yl-[2-(pyridin-3-ylmethylamino)pyrimidin-5-yl]methanone (PubChem CID 139580302) has the molecular formula C19H23N5O2 and a molecular weight of 353.43 g/mol. Its IUPAC name is 8-oxa-2-azaspiro[4.5]decan-2-yl-[2-(pyridin-3-ylmethylamino)pyrimidin-5-yl]methanone.
| Compound Name | 8-oxa-2-azaspiro[4.5]decan-2-yl-[2-(pyridin-3-ylmethylamino)pyrimidin-5-yl]methanone |
|---|---|
| PubChem CID | 139580302 |
| Molecular Formula | C19H23N5O2 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 8-oxa-2-azaspiro[4.5]decan-2-yl-[2-(pyridin-3-ylmethylamino)pyrimidin-5-yl]methanone |
| SMILES | O=C(c1cnc(NCc2cccnc2)nc1)N1CCC2(CCOCC2)C1 |
| InChI | InChI=1S/C19H23N5O2/c25-17(24-7-3-19(14-24)4-8-26-9-5-19)16-12-22-18(23-13-16)21-11-15-2-1-6-20-10-15/h1-2,6,10,12-13H,3-5,7-9,11,14H2,(H,21,22,23) |
| InChIKey | RGWBXUGFKIKCDU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |