C17H21N7O2 — CID 139580313
[(7R,8aS)-7-hydroxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[2-(pyrazin-2-ylmethylamino)pyrimidin-5-yl]methanone (PubChem CID 139580313) has the molecular formula C17H21N7O2 and a molecular weight of 355.40 g/mol. Its IUPAC name is [(7R,8aS)-7-hydroxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[2-(pyrazin-2-ylmethylamino)pyrimidin-5-yl]methanone.
| Compound Name | [(7R,8aS)-7-hydroxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[2-(pyrazin-2-ylmethylamino)pyrimidin-5-yl]methanone |
|---|---|
| PubChem CID | 139580313 |
| Molecular Formula | C17H21N7O2 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | [(7R,8aS)-7-hydroxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[2-(pyrazin-2-ylmethylamino)pyrimidin-5-yl]methanone |
| SMILES | O=C(c1cnc(NCc2cnccn2)nc1)N1CCN2C[C@H](O)C[C@H]2C1 |
| InChI | InChI=1S/C17H21N7O2/c25-15-5-14-10-24(4-3-23(14)11-15)16(26)12-6-20-17(21-7-12)22-9-13-8-18-1-2-19-13/h1-2,6-8,14-15,25H,3-5,9-11H2,(H,20,21,22)/t14-,15+/m0/s1 |
| InChIKey | ORGSBYLCMNIYKZ-LSDHHAIUSA-N |
| XLogP | -0.23 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |