C15H18N6O — CID 139580345
piperidin-1-yl-[2-(pyrimidin-5-ylmethylamino)pyrimidin-5-yl]methanone (PubChem CID 139580345) has the molecular formula C15H18N6O and a molecular weight of 298.35 g/mol. Its IUPAC name is piperidin-1-yl-[2-(pyrimidin-5-ylmethylamino)pyrimidin-5-yl]methanone.
| Compound Name | piperidin-1-yl-[2-(pyrimidin-5-ylmethylamino)pyrimidin-5-yl]methanone |
|---|---|
| PubChem CID | 139580345 |
| Molecular Formula | C15H18N6O |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | piperidin-1-yl-[2-(pyrimidin-5-ylmethylamino)pyrimidin-5-yl]methanone |
| SMILES | O=C(c1cnc(NCc2cncnc2)nc1)N1CCCCC1 |
| InChI | InChI=1S/C15H18N6O/c22-14(21-4-2-1-3-5-21)13-9-19-15(20-10-13)18-8-12-6-16-11-17-7-12/h6-7,9-11H,1-5,8H2,(H,18,19,20) |
| InChIKey | ZKMYKILWELCQPZ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |