C18H23N7O — CID 139580383
[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[2-[[(1S)-1-pyrazin-2-ylethyl]amino]pyrimidin-5-yl]methanone (PubChem CID 139580383) has the molecular formula C18H23N7O and a molecular weight of 353.43 g/mol. Its IUPAC name is [(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[2-[[(1S)-1-pyrazin-2-ylethyl]amino]pyrimidin-5-yl]methanone.
| Compound Name | [(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[2-[[(1S)-1-pyrazin-2-ylethyl]amino]pyrimidin-5-yl]methanone |
|---|---|
| PubChem CID | 139580383 |
| Molecular Formula | C18H23N7O |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | [(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[2-[[(1S)-1-pyrazin-2-ylethyl]amino]pyrimidin-5-yl]methanone |
| SMILES | C[C@H](Nc1ncc(C(=O)N2CCN3CCC[C@@H]3C2)cn1)c1cnccn1 |
| InChI | InChI=1S/C18H23N7O/c1-13(16-11-19-4-5-20-16)23-18-21-9-14(10-22-18)17(26)25-8-7-24-6-2-3-15(24)12-25/h4-5,9-11,13,15H,2-3,6-8,12H2,1H3,(H,21,22,23)/t13-,15+/m0/s1 |
| InChIKey | UUUZKCLWBQMARZ-DZGCQCFKSA-N |
| XLogP | 1.36 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |