C27H33F3N6O3 — CID 139580548
(2S,3R)-3-[(2-amino-4-pyridinyl)methyl]-1-N-(1-cyclohexyl-2,2,2-trifluoroethyl)-2-N-ethyl-2-N-(2-methyl-4-pyridinyl)-4-oxoazetidine-1,2-dicarboxamide (PubChem CID 139580548) has the molecular formula C27H33F3N6O3 and a molecular weight of 546.59 g/mol. Its IUPAC name is (2S,3R)-3-[(2-amino-4-pyridinyl)methyl]-1-N-(1-cyclohexyl-2,2,2-trifluoroethyl)-2-N-ethyl-2-N-(2-methyl-4-pyridinyl)-4-oxoazetidine-1,2-dicarboxamide.
| Compound Name | (2S,3R)-3-[(2-amino-4-pyridinyl)methyl]-1-N-(1-cyclohexyl-2,2,2-trifluoroethyl)-2-N-ethyl-2-N-(2-methyl-4-pyridinyl)-4-oxoazetidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 139580548 |
| Molecular Formula | C27H33F3N6O3 |
| Molecular Weight | 546.59 g/mol |
| Exact Mass | 546.26 |
| IUPAC Name | (2S,3R)-3-[(2-amino-4-pyridinyl)methyl]-1-N-(1-cyclohexyl-2,2,2-trifluoroethyl)-2-N-ethyl-2-N-(2-methyl-4-pyridinyl)-4-oxoazetidine-1,2-dicarboxamide |
| SMILES | CCN(C(=O)[C@@H]1[C@@H](Cc2ccnc(N)c2)C(=O)N1C(=O)NC(C1CCCCC1)C(F)(F)F)c1ccnc(C)c1 |
| InChI | InChI=1S/C27H33F3N6O3/c1-3-35(19-10-12-32-16(2)13-19)25(38)22-20(14-17-9-11-33-21(31)15-17)24(37)36(22)26(39)34-23(27(28,29)30)18-7-5-4-6-8-18/h9-13,15,18,20,22-23H,3-8,14H2,1-2H3,(H2,31,33)(H,34,39)/t20-,22+,23?/m1/s1 |
| InChIKey | VAKKQODWJYNZFZ-PTCKQWLISA-N |
| XLogP | 4.01 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.59 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |