C10H10FN5O — CID 139581196
(5S)-5-(fluoromethyl)-5,6-dihydrotetrazolo[1,5-d][1,4]benzoxazepin-8-amine (PubChem CID 139581196) has the molecular formula C10H10FN5O and a molecular weight of 235.22 g/mol. Its IUPAC name is (5S)-5-(fluoromethyl)-5,6-dihydrotetrazolo[1,5-d][1,4]benzoxazepin-8-amine.
| Compound Name | (5S)-5-(fluoromethyl)-5,6-dihydrotetrazolo[1,5-d][1,4]benzoxazepin-8-amine |
|---|---|
| PubChem CID | 139581196 |
| Molecular Formula | C10H10FN5O |
| Molecular Weight | 235.22 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | (5S)-5-(fluoromethyl)-5,6-dihydrotetrazolo[1,5-d][1,4]benzoxazepin-8-amine |
| SMILES | Nc1cccc2c1OC[C@@H](CF)n1nnnc1-2 |
| InChI | InChI=1S/C10H10FN5O/c11-4-6-5-17-9-7(2-1-3-8(9)12)10-13-14-15-16(6)10/h1-3,6H,4-5,12H2/t6-/m1/s1 |
| InChIKey | QSWOSLPVDBWIRQ-ZCFIWIBFSA-N |
| XLogP | 0.83 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.22 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|