C19H17Cl2FN4O4S — CID 139581457
(2R,3R,4S,5R,6R)-4-[4-(4-chloro-3-fluorophenyl)triazol-1-yl]-2-[(5-chloro-3-pyridinyl)sulfanyl]-6-(hydroxymethyl)oxane-3,5-diol (PubChem CID 139581457) has the molecular formula C19H17Cl2FN4O4S and a molecular weight of 487.34 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-4-[4-(4-chloro-3-fluorophenyl)triazol-1-yl]-2-[(5-chloro-3-pyridinyl)sulfanyl]-6-(hydroxymethyl)oxane-3,5-diol.
| Compound Name | (2R,3R,4S,5R,6R)-4-[4-(4-chloro-3-fluorophenyl)triazol-1-yl]-2-[(5-chloro-3-pyridinyl)sulfanyl]-6-(hydroxymethyl)oxane-3,5-diol |
|---|---|
| PubChem CID | 139581457 |
| Molecular Formula | C19H17Cl2FN4O4S |
| Molecular Weight | 487.34 g/mol |
| Exact Mass | 486.03 |
| IUPAC Name | (2R,3R,4S,5R,6R)-4-[4-(4-chloro-3-fluorophenyl)triazol-1-yl]-2-[(5-chloro-3-pyridinyl)sulfanyl]-6-(hydroxymethyl)oxane-3,5-diol |
| SMILES | OC[C@H]1O[C@H](Sc2cncc(Cl)c2)[C@H](O)[C@@H](n2cc(-c3ccc(Cl)c(F)c3)nn2)[C@H]1O |
| InChI | InChI=1S/C19H17Cl2FN4O4S/c20-10-4-11(6-23-5-10)31-19-18(29)16(17(28)15(8-27)30-19)26-7-14(24-25-26)9-1-2-12(21)13(22)3-9/h1-7,15-19,27-29H,8H2/t15-,16+,17+,18-,19-/m1/s1 |
| InChIKey | YGCUIZJEHKOBCY-ICBNADEASA-N |
| XLogP | 2.56 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |