C33H33N5O2S2 — CID 139582359
N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[3-[4-(3-methylbutoxy)phenyl]-1-phenylpyrazol-4-yl]cyclopropane-1-carboxamide (PubChem CID 139582359) has the molecular formula C33H33N5O2S2 and a molecular weight of 595.79 g/mol. Its IUPAC name is N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[3-[4-(3-methylbutoxy)phenyl]-1-phenylpyrazol-4-yl]cyclopropane-1-carboxamide.
| Compound Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[3-[4-(3-methylbutoxy)phenyl]-1-phenylpyrazol-4-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 139582359 |
| Molecular Formula | C33H33N5O2S2 |
| Molecular Weight | 595.79 g/mol |
| Exact Mass | 595.21 |
| IUPAC Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[3-[4-(3-methylbutoxy)phenyl]-1-phenylpyrazol-4-yl]cyclopropane-1-carboxamide |
| SMILES | CC(C)CCOc1ccc(-c2nn(-c3ccccc3)cc2C2CC2C(=O)Nc2nnc(SCc3ccccc3)s2)cc1 |
| InChI | InChI=1S/C33H33N5O2S2/c1-22(2)17-18-40-26-15-13-24(14-16-26)30-29(20-38(37-30)25-11-7-4-8-12-25)27-19-28(27)31(39)34-32-35-36-33(42-32)41-21-23-9-5-3-6-10-23/h3-16,20,22,27-28H,17-19,21H2,1-2H3,(H,34,35,39) |
| InChIKey | DSXAKJSVZKHFFS-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.79 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|