C20H18N4O3S — CID 139582404
7-benzyl-6-imino-13-methyl-5-methylsulfonyl-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-2-one (PubChem CID 139582404) has the molecular formula C20H18N4O3S and a molecular weight of 394.46 g/mol. Its IUPAC name is 7-benzyl-6-imino-13-methyl-5-methylsulfonyl-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-2-one.
| Compound Name | 7-benzyl-6-imino-13-methyl-5-methylsulfonyl-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-2-one |
|---|---|
| PubChem CID | 139582404 |
| Molecular Formula | C20H18N4O3S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 7-benzyl-6-imino-13-methyl-5-methylsulfonyl-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-2-one |
| SMILES | [H]/N=c1\c(S(C)(=O)=O)cc2c(=O)n3cc(C)ccc3nc2n1Cc1ccccc1 |
| InChI | InChI=1S/C20H18N4O3S/c1-13-8-9-17-22-19-15(20(25)23(17)11-13)10-16(28(2,26)27)18(21)24(19)12-14-6-4-3-5-7-14/h3-11,21H,12H2,1-2H3/b21-18+ |
| InChIKey | VWZRTBVZOQSOIH-DYTRJAOYSA-N |
| XLogP | 1.89 |
| TPSA | 97.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|