About 2-[2-(4-fluorophenyl)cyclopropyl]-5-(methylamino)-1,3-oxazole-4-carbonitrile
2-[2-(4-fluorophenyl)cyclopropyl]-5-(methylamino)-1,3-oxazole-4-carbonitrile (PubChem CID 139582687) has the molecular formula C14H12FN3O
and a molecular weight of 257.27 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)cyclopropyl]-5-(methylamino)-1,3-oxazole-4-carbonitrile.
Molecular Properties
| Compound Name | 2-[2-(4-fluorophenyl)cyclopropyl]-5-(methylamino)-1,3-oxazole-4-carbonitrile |
| PubChem CID | 139582687 |
| Molecular Formula | C14H12FN3O |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 2-[2-(4-fluorophenyl)cyclopropyl]-5-(methylamino)-1,3-oxazole-4-carbonitrile |
| SMILES | CNc1oc(C2CC2c2ccc(F)cc2)nc1C#N |
| InChI | InChI=1S/C14H12FN3O/c1-17-14-12(7-16)18-13(19-14)11-6-10(11)8-2-4-9(15)5-3-8/h2-5,10-11,17H,6H2,1H3 |
| InChIKey | UXKFATQMIYTUJM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(4-fluorophenyl)cyclopropyl]-5-(methylamino)-1,3-oxazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(4-fluorophenyl)cyclopropyl]-5-(methylamino)-1,3-oxazole-4-carbonitrile?
The IUPAC name of 2-[2-(4-fluorophenyl)cyclopropyl]-5-(methylamino)-1,3-oxazole-4-carbonitrile (CID 139582687) is 2-[2-(4-fluorophenyl)cyclopropyl]-5-(methylamino)-1,3-oxazole-4-carbonitrile.
What is the SMILES notation for 2-[2-(4-fluorophenyl)cyclopropyl]-5-(methylamino)-1,3-oxazole-4-carbonitrile?
The canonical SMILES for 2-[2-(4-fluorophenyl)cyclopropyl]-5-(methylamino)-1,3-oxazole-4-carbonitrile is CNc1oc(C2CC2c2ccc(F)cc2)nc1C#N.
What is the InChIKey of 2-[2-(4-fluorophenyl)cyclopropyl]-5-(methylamino)-1,3-oxazole-4-carbonitrile?
The InChIKey is UXKFATQMIYTUJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12FN3O/c1-17-14-12(7-16)18-13(19-14)11-6-10(11)8-2-4-9(15)5-3-8/h2-5,10-11,17H,6H2,1H3.
What are the key properties of 2-[2-(4-fluorophenyl)cyclopropyl]-5-(methylamino)-1,3-oxazole-4-carbonitrile?
2-[2-(4-fluorophenyl)cyclopropyl]-5-(methylamino)-1,3-oxazole-4-carbonitrile has a molecular weight of 257.27 g/mol, XLogP of 3.00, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4-fluorophenyl)cyclopropyl]-5-(methylamino)-1,3-oxazole-4-carbonitrile is sourced from PubChem (CID 139582687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).