C36H30F4N4O5 — CID 139582710
N-[4-(1,1,2,2-tetrafluoroethoxy)-3-[[5-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,2-oxazole-3-carbonyl]amino]phenyl]-5-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,2-oxazole-3-carboxamide (PubChem CID 139582710) has the molecular formula C36H30F4N4O5 and a molecular weight of 674.65 g/mol. Its IUPAC name is N-[4-(1,1,2,2-tetrafluoroethoxy)-3-[[5-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,2-oxazole-3-carbonyl]amino]phenyl]-5-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-[4-(1,1,2,2-tetrafluoroethoxy)-3-[[5-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,2-oxazole-3-carbonyl]amino]phenyl]-5-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 139582710 |
| Molecular Formula | C36H30F4N4O5 |
| Molecular Weight | 674.65 g/mol |
| Exact Mass | 674.22 |
| IUPAC Name | N-[4-(1,1,2,2-tetrafluoroethoxy)-3-[[5-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,2-oxazole-3-carbonyl]amino]phenyl]-5-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,2-oxazole-3-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)C(F)F)c(NC(=O)c2cc(-c3ccc4c(c3)CCCC4)on2)c1)c1cc(-c2ccc3c(c2)CCCC3)on1 |
| InChI | InChI=1S/C36H30F4N4O5/c37-35(38)36(39,40)47-30-14-13-26(41-33(45)28-18-31(48-43-28)24-11-9-20-5-1-3-7-22(20)15-24)17-27(30)42-34(46)29-19-32(49-44-29)25-12-10-21-6-2-4-8-23(21)16-25/h9-19,35H,1-8H2,(H,41,45)(H,42,46) |
| InChIKey | LRDNPDQSZBHFNR-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.65 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|